* RO forced reactions, products and their associated rate constant
* ----------------------------------------------------------
*
* this file is read up to the keyword END.
* Comment line (* as first character) can be placed  
* everywhere in the file.
*
* - first column : gives the formula of the species (must start at the
*   character of the line
* - second column : gives the formula of 2nd reactant
* - third and fourth columns : stochiometric coefficient and first product
* - 5th and 6th columns      : stochiometric coefficient and second product
* - 7th and 8th columns      : stochiometric coefficient and third product
* - 9th column : arrhenius coefficient for the reaction
* A 'space 
*   character' must be inserted between '|' and the beginning of the 
*   formula
* if no product, let 1 or any value for the associated stochimetric coefficient, no '-'
* for inorganic species, put the gecko name without the 'G' : e.g. HO, NO, NO2, O3 ...
* for reaction with O2, the second reactant must be OXYGEN.
*
******************************************************************************************************
C1H2CH(OH)Cd(CH3)=CdHCH2C1HC(O.)(CH3)CH3     | - | 1 | C1H(OH)CH2CH(OO.)CH2CdH=Cd1CH3            | 1 | CH3COCH3    | 1 | - |  0.080E+15  0.0   4879  
C1H2CH(OH)Cd(CH3)=CdHCH2C1HC(O.)(CH3)CH3     | - | 1 | C1H2COCd(CH3)=CdHCH2C1HC(OH)(CH3)CH3      | 1 | -           | 1 | - |  0.120E+15  0.0   4879    
*
*CH3CH2CH2CH2CH(O.)CH2CH3                     | - | 1 | CH3CH2CH2CH2CHO                      | 1 | CH3CH2(OO.)   | 1 | - | 1.11 1.1 1111
*CH3CH2CH2CH2CH(O.)CH2CH3                     | - | 1 | CH3CH(O.)CH2CH2CH(OH)CH2CH3          | 1 | - | 1 | - | 2.22 2.2 2222
*CH3CH2CH2CH2CH(O.)CH2CH3                     | OXYGEN | 1 | CH3CH2CH2CH2COCH2CH3            | 1 | - | 1 | - | 3.33 3.3 3333
END