* List of the 'constrained' VOC + OH reactions
* ---------------------------------------------
*
* this file is read up to the keyword END.
* Comment line (* as first character) can be placed  
* everywhere in the file, EXCEPT BETWEEN A GIVEN
* BLOCK OF DATA.
*
* for each VOC, format of the file is :
*     - first line = chemical formula of the VOC considered + number
*                    of different compounds (i.e line to be read) that 
*                    are produced by the reaction.
*     - following lines = yield + chemical formula of the major 
*                         product + name of the coproducts (6 
*                         character). The number of coproduct allowed 
*                         must not exceed mcp (see general.h). A 
*                         single " " be given between ':' or '+' and 
*                         the species.
* For each VOC, the sum of the various yields must be 1.
*
*****************************************************************
*
* Orlando and Tyndall IJCK 2001
CHOCHO : 2
0.70 : CHO.   + CO        
0.30 : CHOCO. 
*
* SAPRC 99 
CH3-O-CH2-O-CH3 : 2  
0.67 : CH3-O-CH2-O-CH2(.) 
0.33 : CH3-O-CH(.)-O-CH3 
*
* SAPRC 99
CH3CO-O-CH3 : 1
1.00 : CH3CO-O-CH2(.)
*
* Grussdorf 1994 (Ber. Bunsenges. Phys. Chem. 98, 546-553) [product = CH2(OH).]
CdH2=CdO : 1
1.00 : CH2O + CO
*
* a-pinene : Peeters et al. 2001
C12HCH2CH(C1(CH3)CH3)CH2CdH=Cd2CH3 : 6
0.09 : C12HCH2CH(C1(CH3)CH3)CdH=CdHC2(OO.)CH3                    
0.01 : CH3C1(CH3)CH(CH2C12H)CH2CH(OO.)Cd2=CdH2                    
0.02 : C12HCH2CH(C1(CH2(OO.))CH3)CH2CdH=Cd2CH3                    
0.22 : C12HCH2CH(C1(CH3)CH3)CH2CH(OH)C2(OO.)CH3                
0.44 : C12HCH2CH(C1(CH3)CH3)CH2CH(OO.)C2(OH)CH3                
0.22 : C1H2CH(OH)Cd(CH3)=CdHCH2C1HC(OO.)(CH3)CH3               
*
* Isoprene + OH; Paulot 2009 (Atmos. Chem. Phys. 9, 1479-1501) Figure 1.
* specify peroxy radical products to avoid activating delocalisation routine!
CH3Cd(=CdH2)CdH=CdH2 : 6
0.02 : CdH2=CdHC(OH)(CH3)CH2(OO.)
0.05 : CH3Cd(=CdH2)CH(OH)CH2(OO.)
0.41 : CH3C(OO.)(CH2(OH))CdH=CdH2
0.23 : CH2(OH)CH(OO.)Cd(CH3)=CdH2
0.15 : CH3Cd(CH2(OH))=CdHCH2(OO.)
0.14 : CH2(OH)CdH=Cd(CH3)CH2(OO.)
*
* Isoprene +OH (reduced mechanism version):
*CH3Cd(=CdH2)CdH=CdH2 : 4
*0.46 : CH3C(OO.)(CH2(OH))CdH=CdH2
*0.25 : CH2(OH)CH(OO.)Cd(CH3)=CdH2
*0.15 : CH3Cd(CH2(OH))=CdHCH2(OO.)
*0.14 : CH2(OH)CdH=Cd(CH3)CH2(OO.)
*
* Isoprene MCM 3.3
*CH3Cd(=CdH2)CdH=CdH2 : 5
*0.56 : CH2(OO.)CdH=Cd(CH3)CH2(OH)
*0.022 : CH2(OO.)CH(OH)Cd(CH3)=CdH2
*0.02 : CH3Cd(=CdH2)CH2CHO + HO2
*0.042 : CH3COCH2CdH=CdH2
*0.356 : CH2(OO.)Cd(CH3)=CdHCH2(OH)
END
===============================================================