* List of the 'constrained' VOC + OH reactions
* ---------------------------------------------
*
* this file is read up to the keyword END.
* Comment line (* as first character) can be placed  
* everywhere in the file, EXCEPT BETWEEN A GIVEN
* BLOCK OF DATA.
*
* for each VOC, format of the file is :
*     - first line = chemical formula of the VOC considered + number
*                    of different compounds (i.e line to be read) that 
*                    are produced by the reaction.
*     - following lines = yield + chemical formula of the major 
*                         product + name of the coproducts (6 
*                         character). The number of coproduct allowed 
*                         must not exceed mcp (see general.h). A 
*                         single " " be given between ':' or '+' and 
*                         the species.
****************************************************************
*
* /!\ WARNING /!\ For each VOC, there is no control on the sum of the yields
* /!\ WARNING /!\  Be very carful when writing the forced reactions, especially the yields.
*
*****************************************************************
**** The following lines are an example for apinene while there are no forced reactions.
*C12HCH2CH(C1(CH3)CH3)CH2CdH=Cd2CH3 : 4
*0.70 : HO
*0.30 : CHOCH2C1HCH2CH(C1(CH3)CH3)COCH2(OO.) 
*0.40 : CH3COC(OO.)(C1(CH3)CH3)CH2C1HCH2CHO 
*0.30 : CH3COCH(C1(CH3)CH3)CH2C1HCH2CO(OH)
*
END
===============================================================