* List of the 'constrained' VOC + OH reactions
* ---------------------------------------------
*
* this file is read up to the keyword END.
* Comment line (* as first character) can be placed  
* everywhere in the file, EXCEPT BETWEEN A GIVEN
* BLOCK OF DATA.
*
* for each VOC, format of the file is :
*     - first line = chemical formula of the VOC considered + number
*                    of different compounds (i.e line to be read) that 
*                    are produced by the reaction.
*     - following lines = yield + chemical formula of the major 
*                         product + name of the coproducts (6 
*                         character). The number of coproduct allowed 
*                         must not exceed mcp (see general.h). A 
*                         single " " be given between ':' or '+' and 
*                         the species.
* For each VOC, the sum of the various yield must be 1.
*
*****************************************************************
* Orlando and Tyndall IJCK 2001
CHOCHO : 2
0.70  : CHO.   + HNO3  + CO
0.30  : CHOCO. + HNO3 
* Isoprene MCM 3.3
*CH3Cd(=CdH2)CdH=CdH2 : 1
*1.00  : CH2(ONO2)CdH=Cd(CH3)CH2(OO.)
END                    
=========================================================